C16H13ClO5 — CID 175431329
5,7-dihydroxy-8-methoxy-2-phenylchromen-4-one;hydrochloride (PubChem CID 175431329) has the molecular formula C16H13ClO5 and a molecular weight of 320.73 g/mol. Its IUPAC name is 5,7-dihydroxy-8-methoxy-2-phenylchromen-4-one;hydrochloride.
| Compound Name | 5,7-dihydroxy-8-methoxy-2-phenylchromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 175431329 |
| Molecular Formula | C16H13ClO5 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5,7-dihydroxy-8-methoxy-2-phenylchromen-4-one;hydrochloride |
| SMILES | COc1c(O)cc(O)c2c(=O)cc(-c3ccccc3)oc12.Cl |
| InChI | InChI=1S/C16H12O5.ClH/c1-20-15-12(19)7-10(17)14-11(18)8-13(21-16(14)15)9-5-3-2-4-6-9;/h2-8,17,19H,1H3;1H |
| InChIKey | RDHQCBSDUKIONS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |