C16H12O8S — CID 155301521
[5,7-dihydroxy-2-(3-methylphenyl)-4-oxochromen-8-yl] hydrogen sulfate (PubChem CID 155301521) has the molecular formula C16H12O8S and a molecular weight of 364.33 g/mol. Its IUPAC name is [5,7-dihydroxy-2-(3-methylphenyl)-4-oxochromen-8-yl] hydrogen sulfate.
| Compound Name | [5,7-dihydroxy-2-(3-methylphenyl)-4-oxochromen-8-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 155301521 |
| Molecular Formula | C16H12O8S |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [5,7-dihydroxy-2-(3-methylphenyl)-4-oxochromen-8-yl] hydrogen sulfate |
| SMILES | Cc1cccc(-c2cc(=O)c3c(O)cc(O)c(OS(=O)(=O)O)c3o2)c1 |
| InChI | InChI=1S/C16H12O8S/c1-8-3-2-4-9(5-8)13-7-11(18)14-10(17)6-12(19)15(16(14)23-13)24-25(20,21)22/h2-7,17,19H,1H3,(H,20,21,22) |
| InChIKey | MIZPUQJACRRWAQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|