C23H17NO10S — CID 101496531
[5-(5,7-dihydroxy-8-nitro-4-oxochromen-2-yl)-2-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 101496531) has the molecular formula C23H17NO10S and a molecular weight of 499.45 g/mol. Its IUPAC name is [5-(5,7-dihydroxy-8-nitro-4-oxochromen-2-yl)-2-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [5-(5,7-dihydroxy-8-nitro-4-oxochromen-2-yl)-2-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101496531 |
| Molecular Formula | C23H17NO10S |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | [5-(5,7-dihydroxy-8-nitro-4-oxochromen-2-yl)-2-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O)c([N+](=O)[O-])c3o2)cc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H17NO10S/c1-12-3-6-14(7-4-12)35(30,31)34-20-9-13(5-8-18(20)32-2)19-11-16(26)21-15(25)10-17(27)22(24(28)29)23(21)33-19/h3-11,25,27H,1-2H3 |
| InChIKey | MCOFNDBULXEZGH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|