C16H12O7S — CID 46886180
(5,7-dihydroxy-4-oxochromen-3-yl) 4-methylbenzenesulfonate (PubChem CID 46886180) has the molecular formula C16H12O7S and a molecular weight of 348.33 g/mol. Its IUPAC name is (5,7-dihydroxy-4-oxochromen-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (5,7-dihydroxy-4-oxochromen-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46886180 |
| Molecular Formula | C16H12O7S |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | (5,7-dihydroxy-4-oxochromen-3-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2coc3cc(O)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C16H12O7S/c1-9-2-4-11(5-3-9)24(20,21)23-14-8-22-13-7-10(17)6-12(18)15(13)16(14)19/h2-8,17-18H,1H3 |
| InChIKey | VHRNBEHWNYPYLM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|