C10H6O5 — CID 130033161
5,7-dihydroxy-4-oxochromene-3-carbaldehyde (PubChem CID 130033161) has the molecular formula C10H6O5 and a molecular weight of 206.15 g/mol. Its IUPAC name is 5,7-dihydroxy-4-oxochromene-3-carbaldehyde.
| Compound Name | 5,7-dihydroxy-4-oxochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 130033161 |
| Molecular Formula | C10H6O5 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 5,7-dihydroxy-4-oxochromene-3-carbaldehyde |
| SMILES | O=Cc1coc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C10H6O5/c11-3-5-4-15-8-2-6(12)1-7(13)9(8)10(5)14/h1-4,12-13H |
| InChIKey | OYBCPQJOFBDNAA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|