C15H12CaO5 — CID 173012040
calcium;5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;hydride (PubChem CID 173012040) has the molecular formula C15H12CaO5 and a molecular weight of 312.33 g/mol. Its IUPAC name is calcium;5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;hydride.
| Compound Name | calcium;5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;hydride |
|---|---|
| PubChem CID | 173012040 |
| Molecular Formula | C15H12CaO5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | calcium;5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;hydride |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(O)c12.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C15H10O5.Ca.2H/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19;;;/h1-7,16-18H;;;/q;+2;2*-1 |
| InChIKey | WGXDOMBIDNWUQJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |