C15H11O8P — CID 91573252
[7-hydroxy-3-(4-hydroxyphenyl)-4-oxochromen-5-yl] dihydrogen phosphate (PubChem CID 91573252) has the molecular formula C15H11O8P and a molecular weight of 350.22 g/mol. Its IUPAC name is [7-hydroxy-3-(4-hydroxyphenyl)-4-oxochromen-5-yl] dihydrogen phosphate.
| Compound Name | [7-hydroxy-3-(4-hydroxyphenyl)-4-oxochromen-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91573252 |
| Molecular Formula | C15H11O8P |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | [7-hydroxy-3-(4-hydroxyphenyl)-4-oxochromen-5-yl] dihydrogen phosphate |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(OP(=O)(O)O)c12 |
| InChI | InChI=1S/C15H11O8P/c16-9-3-1-8(2-4-9)11-7-22-12-5-10(17)6-13(14(12)15(11)18)23-24(19,20)21/h1-7,16-17H,(H2,19,20,21) |
| InChIKey | GEOVLGYUKCZSEO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|