C19H20FNO8S — CID 178046132
[2-(4-fluorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl] sulfate;tetramethylazanium (PubChem CID 178046132) has the molecular formula C19H20FNO8S and a molecular weight of 441.43 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl] sulfate;tetramethylazanium.
| Compound Name | [2-(4-fluorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl] sulfate;tetramethylazanium |
|---|---|
| PubChem CID | 178046132 |
| Molecular Formula | C19H20FNO8S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | [2-(4-fluorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl] sulfate;tetramethylazanium |
| SMILES | C[N+](C)(C)C.O=c1cc(-c2ccc(F)cc2)oc2c(OS(=O)(=O)[O-])c(O)cc(O)c12 |
| InChI | InChI=1S/C15H9FO8S.C4H12N/c16-8-3-1-7(2-4-8)12-6-10(18)13-9(17)5-11(19)14(15(13)23-12)24-25(20,21)22;1-5(2,3)4/h1-6,17,19H,(H,20,21,22);1-4H3/q;+1/p-1 |
| InChIKey | KFIOGGVYYYLOGW-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|