C30H18O11 — CID 163090228
8-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one (PubChem CID 163090228) has the molecular formula C30H18O11 and a molecular weight of 554.46 g/mol. Its IUPAC name is 8-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 8-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 163090228 |
| Molecular Formula | C30H18O11 |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 8-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)c(O)c5)oc34)c(O)cc(O)c12 |
| InChI | InChI=1S/C30H18O11/c31-14-4-1-12(2-5-14)23-10-21(38)25-17(34)8-19(36)27(29(25)40-23)28-20(37)9-18(35)26-22(39)11-24(41-30(26)28)13-3-6-15(32)16(33)7-13/h1-11,31-37H |
| InChIKey | CTQMEXNJZGRPKL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 202.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|