C15H10O5 — CID 59800838
6,8-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one (PubChem CID 59800838) has the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. Its IUPAC name is 6,8-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 6,8-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 59800838 |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 6,8-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c(O)cc(O)cc12 |
| InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)14-7-12(18)11-5-10(17)6-13(19)15(11)20-14/h1-7,16-17,19H |
| InChIKey | LVCYVRRZAOZRPF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |