C18H12O4 — CID 141466718
2-(4-hydroxyphenyl)-9-methylfuro[2,3-h]chromen-4-one (PubChem CID 141466718) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-9-methylfuro[2,3-h]chromen-4-one.
| Compound Name | 2-(4-hydroxyphenyl)-9-methylfuro[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 141466718 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-(4-hydroxyphenyl)-9-methylfuro[2,3-h]chromen-4-one |
| SMILES | Cc1coc2ccc3c(=O)cc(-c4ccc(O)cc4)oc3c12 |
| InChI | InChI=1S/C18H12O4/c1-10-9-21-15-7-6-13-14(20)8-16(22-18(13)17(10)15)11-2-4-12(19)5-3-11/h2-9,19H,1H3 |
| InChIKey | SQQGDMRLIXARIZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |