C17H14O4 — CID 95048626
5-hydroxy-2-(4-hydroxyphenyl)-6,7-dimethylchromen-4-one (PubChem CID 95048626) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-hydroxy-2-(4-hydroxyphenyl)-6,7-dimethylchromen-4-one.
| Compound Name | 5-hydroxy-2-(4-hydroxyphenyl)-6,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 95048626 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-6,7-dimethylchromen-4-one |
| SMILES | Cc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(O)c1C |
| InChI | InChI=1S/C17H14O4/c1-9-7-15-16(17(20)10(9)2)13(19)8-14(21-15)11-3-5-12(18)6-4-11/h3-8,18,20H,1-2H3 |
| InChIKey | SXTDDJWOZJCLNW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |