C16H11NO6 — CID 130383696
5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-7-nitrosochromen-4-one (PubChem CID 130383696) has the molecular formula C16H11NO6 and a molecular weight of 313.27 g/mol. Its IUPAC name is 5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-7-nitrosochromen-4-one.
| Compound Name | 5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-7-nitrosochromen-4-one |
|---|---|
| PubChem CID | 130383696 |
| Molecular Formula | C16H11NO6 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-7-nitrosochromen-4-one |
| SMILES | COc1c(N=O)cc2oc(-c3ccc(O)cc3)cc(=O)c2c1O |
| InChI | InChI=1S/C16H11NO6/c1-22-16-10(17-21)6-13-14(15(16)20)11(19)7-12(23-13)8-2-4-9(18)5-3-8/h2-7,18,20H,1H3 |
| InChIKey | WHIBFZYFZNZRNR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |