C25H20O9 — CID 68743449
5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 68743449) has the molecular formula C25H20O9 and a molecular weight of 464.43 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 68743449 |
| Molecular Formula | C25H20O9 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)cc3)cc(=O)c2c1O.O=C(O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H12O6.C9H8O3/c1-21-16-11(19)7-13-14(15(16)20)10(18)6-12(22-13)8-2-4-9(17)5-3-8;10-8-4-1-7(2-5-8)3-6-9(11)12/h2-7,17,19-20H,1H3;1-6,10H,(H,11,12)/b;6-3+ |
| InChIKey | CCHJOZRFHHYMJD-GNRCENTLSA-N |
| XLogP | 4.08 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|