C17H14O7S — CID 57405632
5,7-dihydroxy-6-methoxy-2-(4-methylsulfonylphenyl)chromen-4-one (PubChem CID 57405632) has the molecular formula C17H14O7S and a molecular weight of 362.36 g/mol. Its IUPAC name is 5,7-dihydroxy-6-methoxy-2-(4-methylsulfonylphenyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-6-methoxy-2-(4-methylsulfonylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 57405632 |
| Molecular Formula | C17H14O7S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 5,7-dihydroxy-6-methoxy-2-(4-methylsulfonylphenyl)chromen-4-one |
| SMILES | COc1c(O)cc2oc(-c3ccc(S(C)(=O)=O)cc3)cc(=O)c2c1O |
| InChI | InChI=1S/C17H14O7S/c1-23-17-12(19)8-14-15(16(17)20)11(18)7-13(24-14)9-3-5-10(6-4-9)25(2,21)22/h3-8,19-20H,1-2H3 |
| InChIKey | NVIIVUGBYXIVJT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |