C18H14O6 — CID 162875618
6-acetyl-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one (PubChem CID 162875618) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is 6-acetyl-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 6-acetyl-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 162875618 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 6-acetyl-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(C(C)=O)c(O)cc3o2)cc1 |
| InChI | InChI=1S/C18H14O6/c1-9(19)16-12(20)8-15-17(18(16)22)13(21)7-14(24-15)10-3-5-11(23-2)6-4-10/h3-8,20,22H,1-2H3 |
| InChIKey | KEZPHBGAJBKUJJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |