C16H12O6Se — CID 172843365
5,7-dihydroxy-2-(4-hydroxyphenyl)selanyl-6-methoxychromen-4-one (PubChem CID 172843365) has the molecular formula C16H12O6Se and a molecular weight of 379.23 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)selanyl-6-methoxychromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)selanyl-6-methoxychromen-4-one |
|---|---|
| PubChem CID | 172843365 |
| Molecular Formula | C16H12O6Se |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)selanyl-6-methoxychromen-4-one |
| SMILES | COc1c(O)cc2oc([Se]c3ccc(O)cc3)cc(=O)c2c1O |
| InChI | InChI=1S/C16H12O6Se/c1-21-16-11(19)6-12-14(15(16)20)10(18)7-13(22-12)23-9-4-2-8(17)3-5-9/h2-7,17,19-20H,1H3 |
| InChIKey | XCBXQGIWKWMVQT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|