C31H28O13 — CID 163189540
[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 163189540) has the molecular formula C31H28O13 and a molecular weight of 608.55 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163189540 |
| Molecular Formula | C31H28O13 |
| Molecular Weight | 608.55 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | COc1c(O[C@H]2O[C@H](COC(=O)/C=C/c3ccc(O)cc3)[C@@H](O)[C@@H](O)[C@@H]2O)cc2oc(-c3ccc(O)cc3)cc(=O)c2c1O |
| InChI | InChI=1S/C31H28O13/c1-40-30-22(13-21-25(27(30)37)19(34)12-20(42-21)16-5-9-18(33)10-6-16)43-31-29(39)28(38)26(36)23(44-31)14-41-24(35)11-4-15-2-7-17(32)8-3-15/h2-13,23,26,28-29,31-33,36-39H,14H2,1H3/b11-4+/t23-,26-,28-,29+,31+/m1/s1 |
| InChIKey | UOZVWIWAQMZYKF-SOSGAIPPSA-N |
| XLogP | 2.03 |
| TPSA | 205.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|