C30H26O11 — CID 162866445
[3,4,5-trihydroxy-6-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162866445) has the molecular formula C30H26O11 and a molecular weight of 562.53 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [3,4,5-trihydroxy-6-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162866445 |
| Molecular Formula | C30H26O11 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | [3,4,5-trihydroxy-6-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)cc1)OCC1OC(Oc2cc(O)c3c(=O)cc(-c4ccccc4)oc3c2)C(O)C(O)C1O |
| InChI | InChI=1S/C30H26O11/c31-18-9-6-16(7-10-18)8-11-25(34)38-15-24-27(35)28(36)29(37)30(41-24)39-19-12-20(32)26-21(33)14-22(40-23(26)13-19)17-4-2-1-3-5-17/h1-14,24,27-32,35-37H,15H2 |
| InChIKey | ZPLXYNINCOZMOC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 176.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|