C17H12Cl2O2 — CID 71739419
6-chloro-2-(4-chlorophenyl)-5,7-dimethylchromen-4-one (PubChem CID 71739419) has the molecular formula C17H12Cl2O2 and a molecular weight of 319.19 g/mol. Its IUPAC name is 6-chloro-2-(4-chlorophenyl)-5,7-dimethylchromen-4-one.
| Compound Name | 6-chloro-2-(4-chlorophenyl)-5,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 71739419 |
| Molecular Formula | C17H12Cl2O2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 6-chloro-2-(4-chlorophenyl)-5,7-dimethylchromen-4-one |
| SMILES | Cc1cc2oc(-c3ccc(Cl)cc3)cc(=O)c2c(C)c1Cl |
| InChI | InChI=1S/C17H12Cl2O2/c1-9-7-15-16(10(2)17(9)19)13(20)8-14(21-15)11-3-5-12(18)6-4-11/h3-8H,1-2H3 |
| InChIKey | GHNLJCXCJIHDRR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |