C14H13ClO4 — CID 54082689
ethyl 6-chloro-5,7-dimethyl-4-oxochromene-2-carboxylate (PubChem CID 54082689) has the molecular formula C14H13ClO4 and a molecular weight of 280.71 g/mol. Its IUPAC name is ethyl 6-chloro-5,7-dimethyl-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 6-chloro-5,7-dimethyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 54082689 |
| Molecular Formula | C14H13ClO4 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | ethyl 6-chloro-5,7-dimethyl-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2c(C)c(Cl)c(C)cc2o1 |
| InChI | InChI=1S/C14H13ClO4/c1-4-18-14(17)11-6-9(16)12-8(3)13(15)7(2)5-10(12)19-11/h5-6H,4H2,1-3H3 |
| InChIKey | MOFMVNRJIZPDSB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |