C18H18O7 — CID 6931801
ethyl 5-hydroxy-6-[[(2S)-oxiran-2-yl]methyl]-8-[[(2R)-oxiran-2-yl]methyl]-4-oxochromene-2-carboxylate (PubChem CID 6931801) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is ethyl 5-hydroxy-6-[[(2S)-oxiran-2-yl]methyl]-8-[[(2R)-oxiran-2-yl]methyl]-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 5-hydroxy-6-[[(2S)-oxiran-2-yl]methyl]-8-[[(2R)-oxiran-2-yl]methyl]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 6931801 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | ethyl 5-hydroxy-6-[[(2S)-oxiran-2-yl]methyl]-8-[[(2R)-oxiran-2-yl]methyl]-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2c(O)c(C[C@H]3CO3)cc(C[C@@H]3CO3)c2o1 |
| InChI | InChI=1S/C18H18O7/c1-2-22-18(21)14-6-13(19)15-16(20)9(4-11-7-23-11)3-10(17(15)25-14)5-12-8-24-12/h3,6,11-12,20H,2,4-5,7-8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | XWPORILQNZQHJZ-NWDGAFQWSA-N |
| XLogP | 1.56 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|