C17H15NO5 — CID 12724133
ethyl 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylate (PubChem CID 12724133) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylate.
| Compound Name | ethyl 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 12724133 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | ethyl 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2c(=O)[nH]c3c(C)c(C)ccc3c2o1 |
| InChI | InChI=1S/C17H15NO5/c1-4-22-17(21)12-7-11(19)13-15(23-12)10-6-5-8(2)9(3)14(10)18-16(13)20/h5-7H,4H2,1-3H3,(H,18,20) |
| InChIKey | OBIXUTKFTBMVJT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|