C17H15NO2 — CID 82046479
2-(4-aminophenyl)-5,7-dimethylchromen-4-one (PubChem CID 82046479) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5,7-dimethylchromen-4-one.
| Compound Name | 2-(4-aminophenyl)-5,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 82046479 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(4-aminophenyl)-5,7-dimethylchromen-4-one |
| SMILES | Cc1cc(C)c2c(=O)cc(-c3ccc(N)cc3)oc2c1 |
| InChI | InChI=1S/C17H15NO2/c1-10-7-11(2)17-14(19)9-15(20-16(17)8-10)12-3-5-13(18)6-4-12/h3-9H,18H2,1-2H3 |
| InChIKey | OCHMRJBKPNYNSH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|