C13H16ClNO2 — CID 82020794
2-(2-aminoethyl)-5,7-dimethylchromen-4-one;hydrochloride (PubChem CID 82020794) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-(2-aminoethyl)-5,7-dimethylchromen-4-one;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-5,7-dimethylchromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 82020794 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2-aminoethyl)-5,7-dimethylchromen-4-one;hydrochloride |
| SMILES | Cc1cc(C)c2c(=O)cc(CCN)oc2c1.Cl |
| InChI | InChI=1S/C13H15NO2.ClH/c1-8-5-9(2)13-11(15)7-10(3-4-14)16-12(13)6-8;/h5-7H,3-4,14H2,1-2H3;1H |
| InChIKey | QMBVCPYXIPHJQQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |