C13H13ClO2 — CID 12868232
3-(chloromethyl)-4,5,7-trimethylchromen-2-one (PubChem CID 12868232) has the molecular formula C13H13ClO2 and a molecular weight of 236.70 g/mol. Its IUPAC name is 3-(chloromethyl)-4,5,7-trimethylchromen-2-one.
| Compound Name | 3-(chloromethyl)-4,5,7-trimethylchromen-2-one |
|---|---|
| PubChem CID | 12868232 |
| Molecular Formula | C13H13ClO2 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-(chloromethyl)-4,5,7-trimethylchromen-2-one |
| SMILES | Cc1cc(C)c2c(C)c(CCl)c(=O)oc2c1 |
| InChI | InChI=1S/C13H13ClO2/c1-7-4-8(2)12-9(3)10(6-14)13(15)16-11(12)5-7/h4-5H,6H2,1-3H3 |
| InChIKey | GJVOGAWFNBXZQQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|