C20H17ClO5 — CID 24797548
2-[3-[(3-chlorophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxyacetic acid (PubChem CID 24797548) has the molecular formula C20H17ClO5 and a molecular weight of 372.80 g/mol. Its IUPAC name is 2-[3-[(3-chlorophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxyacetic acid.
| Compound Name | 2-[3-[(3-chlorophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxyacetic acid |
|---|---|
| PubChem CID | 24797548 |
| Molecular Formula | C20H17ClO5 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[3-[(3-chlorophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxyacetic acid |
| SMILES | Cc1cc(OCC(=O)O)c2c(C)c(Cc3cccc(Cl)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H17ClO5/c1-11-6-16(25-10-18(22)23)19-12(2)15(20(24)26-17(19)7-11)9-13-4-3-5-14(21)8-13/h3-8H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | IZLYQYNTEDSHJH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|