C23H21NO5 — CID 91050170
ethyl 2-[3-[(4-cyanophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxyacetate (PubChem CID 91050170) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is ethyl 2-[3-[(4-cyanophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxyacetate.
| Compound Name | ethyl 2-[3-[(4-cyanophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxyacetate |
|---|---|
| PubChem CID | 91050170 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethyl 2-[3-[(4-cyanophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxyacetate |
| SMILES | CCOC(=O)COc1cc(C)cc2oc(=O)c(Cc3ccc(C#N)cc3)c(C)c12 |
| InChI | InChI=1S/C23H21NO5/c1-4-27-21(25)13-28-19-9-14(2)10-20-22(19)15(3)18(23(26)29-20)11-16-5-7-17(12-24)8-6-16/h5-10H,4,11,13H2,1-3H3 |
| InChIKey | SJFRGUXBZFWZGH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 89.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|