C19H15NO3 — CID 87816608
4-[(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)methyl]benzonitrile (PubChem CID 87816608) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-[(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)methyl]benzonitrile.
| Compound Name | 4-[(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 87816608 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 4-[(5-hydroxy-4,7-dimethyl-2-oxochromen-3-yl)methyl]benzonitrile |
| SMILES | Cc1cc(O)c2c(C)c(Cc3ccc(C#N)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H15NO3/c1-11-7-16(21)18-12(2)15(19(22)23-17(18)8-11)9-13-3-5-14(10-20)6-4-13/h3-8,21H,9H2,1-2H3 |
| InChIKey | LFWQCMOZBBNKKE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|