C23H22O5 — CID 4914747
prop-2-enyl 2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxyacetate (PubChem CID 4914747) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is prop-2-enyl 2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxyacetate.
| Compound Name | prop-2-enyl 2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxyacetate |
|---|---|
| PubChem CID | 4914747 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | prop-2-enyl 2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxyacetate |
| SMILES | C=CCOC(=O)COc1cc(C)cc2oc(=O)c(Cc3ccccc3)c(C)c12 |
| InChI | InChI=1S/C23H22O5/c1-4-10-26-21(24)14-27-19-11-15(2)12-20-22(19)16(3)18(23(25)28-20)13-17-8-6-5-7-9-17/h4-9,11-12H,1,10,13-14H2,2-3H3 |
| InChIKey | ZGYLXQNVVRUVGT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|