C21H20BrNO6S — CID 24797726
2-[3-[(4-bromophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxy-N-methylsulfonylacetamide (PubChem CID 24797726) has the molecular formula C21H20BrNO6S and a molecular weight of 494.36 g/mol. Its IUPAC name is 2-[3-[(4-bromophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxy-N-methylsulfonylacetamide.
| Compound Name | 2-[3-[(4-bromophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxy-N-methylsulfonylacetamide |
|---|---|
| PubChem CID | 24797726 |
| Molecular Formula | C21H20BrNO6S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 2-[3-[(4-bromophenyl)methyl]-4,7-dimethyl-2-oxochromen-5-yl]oxy-N-methylsulfonylacetamide |
| SMILES | Cc1cc(OCC(=O)NS(C)(=O)=O)c2c(C)c(Cc3ccc(Br)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H20BrNO6S/c1-12-8-17(28-11-19(24)23-30(3,26)27)20-13(2)16(21(25)29-18(20)9-12)10-14-4-6-15(22)7-5-14/h4-9H,10-11H2,1-3H3,(H,23,24) |
| InChIKey | KTNKHCLJOAPGEL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|