C20H17BrO4 — CID 3710659
5-[2-(4-bromophenyl)-2-oxoethoxy]-3,4,7-trimethylchromen-2-one (PubChem CID 3710659) has the molecular formula C20H17BrO4 and a molecular weight of 401.26 g/mol. Its IUPAC name is 5-[2-(4-bromophenyl)-2-oxoethoxy]-3,4,7-trimethylchromen-2-one.
| Compound Name | 5-[2-(4-bromophenyl)-2-oxoethoxy]-3,4,7-trimethylchromen-2-one |
|---|---|
| PubChem CID | 3710659 |
| Molecular Formula | C20H17BrO4 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 5-[2-(4-bromophenyl)-2-oxoethoxy]-3,4,7-trimethylchromen-2-one |
| SMILES | Cc1cc(OCC(=O)c2ccc(Br)cc2)c2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C20H17BrO4/c1-11-8-17(19-12(2)13(3)20(23)25-18(19)9-11)24-10-16(22)14-4-6-15(21)7-5-14/h4-9H,10H2,1-3H3 |
| InChIKey | GXQHJRUSZGBXJE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|