C20H25NO5 — CID 171912972
N-(oxan-3-ylmethyl)-2-(3,4,7-trimethyl-2-oxochromen-5-yl)oxyacetamide (PubChem CID 171912972) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is N-(oxan-3-ylmethyl)-2-(3,4,7-trimethyl-2-oxochromen-5-yl)oxyacetamide.
| Compound Name | N-(oxan-3-ylmethyl)-2-(3,4,7-trimethyl-2-oxochromen-5-yl)oxyacetamide |
|---|---|
| PubChem CID | 171912972 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(oxan-3-ylmethyl)-2-(3,4,7-trimethyl-2-oxochromen-5-yl)oxyacetamide |
| SMILES | Cc1cc(OCC(=O)NCC2CCCOC2)c2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C20H25NO5/c1-12-7-16(19-13(2)14(3)20(23)26-17(19)8-12)25-11-18(22)21-9-15-5-4-6-24-10-15/h7-8,15H,4-6,9-11H2,1-3H3,(H,21,22) |
| InChIKey | KVUUSOQIXICKCS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|