C20H25NO6 — CID 171916127
2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxy-N-[(3R,4R)-4-methoxyoxan-3-yl]acetamide (PubChem CID 171916127) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxy-N-[(3R,4R)-4-methoxyoxan-3-yl]acetamide.
| Compound Name | 2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxy-N-[(3R,4R)-4-methoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 171916127 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxy-N-[(3R,4R)-4-methoxyoxan-3-yl]acetamide |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OCC(=O)N[C@@H]3COCC[C@H]3OC)c12 |
| InChI | InChI=1S/C20H25NO6/c1-4-13-9-19(23)27-17-8-12(2)7-16(20(13)17)26-11-18(22)21-14-10-25-6-5-15(14)24-3/h7-9,14-15H,4-6,10-11H2,1-3H3,(H,21,22)/t14-,15-/m1/s1 |
| InChIKey | NLESLMZPBZIOKA-HUUCEWRRSA-N |
| XLogP | 1.96 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|