C23H31N3O5 — CID 171914586
2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]acetamide (PubChem CID 171914586) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]acetamide.
| Compound Name | 2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 171914586 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxy-N-[(3R,4R)-4-(4-methylpiperazin-1-yl)oxolan-3-yl]acetamide |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OCC(=O)N[C@H]3COC[C@@H]3N3CCN(C)CC3)c12 |
| InChI | InChI=1S/C23H31N3O5/c1-4-16-11-22(28)31-20-10-15(2)9-19(23(16)20)30-14-21(27)24-17-12-29-13-18(17)26-7-5-25(3)6-8-26/h9-11,17-18H,4-8,12-14H2,1-3H3,(H,24,27)/t17-,18-/m0/s1 |
| InChIKey | QQJZWDHAEOPIAY-ROUUACIJSA-N |
| XLogP | 1.17 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|