C17H19NO5 — CID 171915504
4-ethyl-5-[2-(3-hydroxyazetidin-1-yl)-2-oxoethoxy]-7-methylchromen-2-one (PubChem CID 171915504) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-ethyl-5-[2-(3-hydroxyazetidin-1-yl)-2-oxoethoxy]-7-methylchromen-2-one.
| Compound Name | 4-ethyl-5-[2-(3-hydroxyazetidin-1-yl)-2-oxoethoxy]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 171915504 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-ethyl-5-[2-(3-hydroxyazetidin-1-yl)-2-oxoethoxy]-7-methylchromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OCC(=O)N3CC(O)C3)c12 |
| InChI | InChI=1S/C17H19NO5/c1-3-11-6-16(21)23-14-5-10(2)4-13(17(11)14)22-9-15(20)18-7-12(19)8-18/h4-6,12,19H,3,7-9H2,1-2H3 |
| InChIKey | WHFJZUUVUSBJEJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|