C20H23NO5 — CID 171910084
5-[2-[(1R,5S,6S)-6-hydroxy-3-azabicyclo[3.2.0]heptan-3-yl]-2-oxoethoxy]-3,4,7-trimethylchromen-2-one (PubChem CID 171910084) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-[2-[(1R,5S,6S)-6-hydroxy-3-azabicyclo[3.2.0]heptan-3-yl]-2-oxoethoxy]-3,4,7-trimethylchromen-2-one.
| Compound Name | 5-[2-[(1R,5S,6S)-6-hydroxy-3-azabicyclo[3.2.0]heptan-3-yl]-2-oxoethoxy]-3,4,7-trimethylchromen-2-one |
|---|---|
| PubChem CID | 171910084 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 5-[2-[(1R,5S,6S)-6-hydroxy-3-azabicyclo[3.2.0]heptan-3-yl]-2-oxoethoxy]-3,4,7-trimethylchromen-2-one |
| SMILES | Cc1cc(OCC(=O)N2C[C@@H]3C[C@H](O)[C@@H]3C2)c2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C20H23NO5/c1-10-4-16(19-11(2)12(3)20(24)26-17(19)5-10)25-9-18(23)21-7-13-6-15(22)14(13)8-21/h4-5,13-15,22H,6-9H2,1-3H3/t13-,14+,15-/m0/s1 |
| InChIKey | VKRMWHCKPUFFCX-ZNMIVQPWSA-N |
| XLogP | 1.94 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|