C23H30N2O4 — CID 171915967
3,4,7-trimethyl-5-[2-[(1S,5S)-9-methyl-3,9-diazabicyclo[3.3.2]decan-3-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 171915967) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 3,4,7-trimethyl-5-[2-[(1S,5S)-9-methyl-3,9-diazabicyclo[3.3.2]decan-3-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 3,4,7-trimethyl-5-[2-[(1S,5S)-9-methyl-3,9-diazabicyclo[3.3.2]decan-3-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171915967 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3,4,7-trimethyl-5-[2-[(1S,5S)-9-methyl-3,9-diazabicyclo[3.3.2]decan-3-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | Cc1cc(OCC(=O)N2C[C@H]3CCC[C@@H](C2)N(C)C3)c2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C23H30N2O4/c1-14-8-19(22-15(2)16(3)23(27)29-20(22)9-14)28-13-21(26)25-11-17-6-5-7-18(12-25)24(4)10-17/h8-9,17-18H,5-7,10-13H2,1-4H3/t17-,18-/m0/s1 |
| InChIKey | QWTDGLZYIXSYTN-ROUUACIJSA-N |
| XLogP | 3.04 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|