C23H27NO5 — CID 171911624
3,4,7-trimethyl-5-[2-[(1R,2R,6S,8R)-4-oxa-10-azatricyclo[6.3.0.02,6]undecan-10-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 171911624) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 3,4,7-trimethyl-5-[2-[(1R,2R,6S,8R)-4-oxa-10-azatricyclo[6.3.0.02,6]undecan-10-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 3,4,7-trimethyl-5-[2-[(1R,2R,6S,8R)-4-oxa-10-azatricyclo[6.3.0.02,6]undecan-10-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171911624 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 3,4,7-trimethyl-5-[2-[(1R,2R,6S,8R)-4-oxa-10-azatricyclo[6.3.0.02,6]undecan-10-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | Cc1cc(OCC(=O)N2C[C@@H]3C[C@@H]4COC[C@@H]4[C@@H]3C2)c2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C23H27NO5/c1-12-4-19(22-13(2)14(3)23(26)29-20(22)5-12)28-11-21(25)24-7-15-6-16-9-27-10-18(16)17(15)8-24/h4-5,15-18H,6-11H2,1-3H3/t15-,16+,17+,18-/m0/s1 |
| InChIKey | HAJXKLCAVAGQEQ-MLHJIOFPSA-N |
| XLogP | 2.84 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|