C24H26N2O5 — CID 171386567
5-[2-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-2-oxoethoxy]-3,4,7-trimethylchromen-2-one (PubChem CID 171386567) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 5-[2-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-2-oxoethoxy]-3,4,7-trimethylchromen-2-one.
| Compound Name | 5-[2-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-2-oxoethoxy]-3,4,7-trimethylchromen-2-one |
|---|---|
| PubChem CID | 171386567 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 5-[2-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-2-oxoethoxy]-3,4,7-trimethylchromen-2-one |
| SMILES | Cc1cc(OCC(=O)N2CCC(O)(c3cccnc3)CC2)c2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C24H26N2O5/c1-15-11-19(22-16(2)17(3)23(28)31-20(22)12-15)30-14-21(27)26-9-6-24(29,7-10-26)18-5-4-8-25-13-18/h4-5,8,11-13,29H,6-7,9-10,14H2,1-3H3 |
| InChIKey | LNEYLIXKVFAXQH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|