C21H24N2O6 — CID 171908720
(4aS,8aR)-6-[2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxyacetyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 171908720) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is (4aS,8aR)-6-[2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxyacetyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aS,8aR)-6-[2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxyacetyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 171908720 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (4aS,8aR)-6-[2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxyacetyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OCC(=O)N3CC[C@H]4OCC(=O)N[C@H]4C3)c12 |
| InChI | InChI=1S/C21H24N2O6/c1-3-13-8-20(26)29-17-7-12(2)6-16(21(13)17)28-11-19(25)23-5-4-15-14(9-23)22-18(24)10-27-15/h6-8,14-15H,3-5,9-11H2,1-2H3,(H,22,24)/t14-,15+/m0/s1 |
| InChIKey | IRUGHSRXWPYHJS-LSDHHAIUSA-N |
| XLogP | 1.16 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|