C20H22F3NO4 — CID 171912684
4-ethyl-7-methyl-5-[2-oxo-2-[4-(trifluoromethyl)piperidin-1-yl]ethoxy]chromen-2-one (PubChem CID 171912684) has the molecular formula C20H22F3NO4 and a molecular weight of 397.39 g/mol. Its IUPAC name is 4-ethyl-7-methyl-5-[2-oxo-2-[4-(trifluoromethyl)piperidin-1-yl]ethoxy]chromen-2-one.
| Compound Name | 4-ethyl-7-methyl-5-[2-oxo-2-[4-(trifluoromethyl)piperidin-1-yl]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 171912684 |
| Molecular Formula | C20H22F3NO4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-ethyl-7-methyl-5-[2-oxo-2-[4-(trifluoromethyl)piperidin-1-yl]ethoxy]chromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OCC(=O)N3CCC(C(F)(F)F)CC3)c12 |
| InChI | InChI=1S/C20H22F3NO4/c1-3-13-10-18(26)28-16-9-12(2)8-15(19(13)16)27-11-17(25)24-6-4-14(5-7-24)20(21,22)23/h8-10,14H,3-7,11H2,1-2H3 |
| InChIKey | KLCNKRNQXVYKCR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|