C20H27ClN2O4 — CID 172896915
5-[2-[3-(aminomethyl)piperidin-1-yl]-2-oxoethoxy]-4-ethyl-7-methylchromen-2-one;hydrochloride (PubChem CID 172896915) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is 5-[2-[3-(aminomethyl)piperidin-1-yl]-2-oxoethoxy]-4-ethyl-7-methylchromen-2-one;hydrochloride.
| Compound Name | 5-[2-[3-(aminomethyl)piperidin-1-yl]-2-oxoethoxy]-4-ethyl-7-methylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 172896915 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 5-[2-[3-(aminomethyl)piperidin-1-yl]-2-oxoethoxy]-4-ethyl-7-methylchromen-2-one;hydrochloride |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OCC(=O)N3CCCC(CN)C3)c12.Cl |
| InChI | InChI=1S/C20H26N2O4.ClH/c1-3-15-9-19(24)26-17-8-13(2)7-16(20(15)17)25-12-18(23)22-6-4-5-14(10-21)11-22;/h7-9,14H,3-6,10-12,21H2,1-2H3;1H |
| InChIKey | NOATWWMTBFMXKS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|