C33H30N2O6 — CID 3771711
methyl 2-[2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 3771711) has the molecular formula C33H30N2O6 and a molecular weight of 550.61 g/mol. Its IUPAC name is methyl 2-[2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 2-[2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 3771711 |
| Molecular Formula | C33H30N2O6 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | methyl 2-[2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)CN1C(=O)COc1cc(C)cc2oc(=O)c(Cc3ccccc3)c(C)c12 |
| InChI | InChI=1S/C33H30N2O6/c1-19-13-28(31-20(2)23(32(37)41-29(31)14-19)15-21-9-5-4-6-10-21)40-18-30(36)35-17-26-24(16-27(35)33(38)39-3)22-11-7-8-12-25(22)34-26/h4-14,27,34H,15-18H2,1-3H3 |
| InChIKey | HQOZIABDJKZPOT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|