C28H33NO6S — CID 6575666
(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate (PubChem CID 6575666) has the molecular formula C28H33NO6S and a molecular weight of 511.64 g/mol. Its IUPAC name is (3-benzyl-4,7-dimethyl-2-oxochromen-5-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate.
| Compound Name | (3-benzyl-4,7-dimethyl-2-oxochromen-5-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 6575666 |
| Molecular Formula | C28H33NO6S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (3-benzyl-4,7-dimethyl-2-oxochromen-5-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)OC(C)(C)C)C(=O)Oc1cc(C)cc2oc(=O)c(Cc3ccccc3)c(C)c12 |
| InChI | InChI=1S/C28H33NO6S/c1-17-14-22-24(18(2)20(25(30)33-22)16-19-10-8-7-9-11-19)23(15-17)34-26(31)21(12-13-36-6)29-27(32)35-28(3,4)5/h7-11,14-15,21H,12-13,16H2,1-6H3,(H,29,32)/t21-/m1/s1 |
| InChIKey | VLURTOGTUBQPIN-OAQYLSRUSA-N |
| XLogP | 5.55 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|