C19H19NO3 — CID 7997786
(4-cyanophenyl)methyl 2-(2,4,6-trimethylphenoxy)acetate (PubChem CID 7997786) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(2,4,6-trimethylphenoxy)acetate.
| Compound Name | (4-cyanophenyl)methyl 2-(2,4,6-trimethylphenoxy)acetate |
|---|---|
| PubChem CID | 7997786 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(2,4,6-trimethylphenoxy)acetate |
| SMILES | Cc1cc(C)c(OCC(=O)OCc2ccc(C#N)cc2)c(C)c1 |
| InChI | InChI=1S/C19H19NO3/c1-13-8-14(2)19(15(3)9-13)23-12-18(21)22-11-17-6-4-16(10-20)5-7-17/h4-9H,11-12H2,1-3H3 |
| InChIKey | OTKWMIBONKBVCA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |