C20H19NO4 — CID 7804150
(4-cyanophenyl)methyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate (PubChem CID 7804150) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate.
| Compound Name | (4-cyanophenyl)methyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
|---|---|
| PubChem CID | 7804150 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
| SMILES | C=CCc1ccc(OCC(=O)OCc2ccc(C#N)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H19NO4/c1-3-4-15-9-10-18(19(11-15)23-2)24-14-20(22)25-13-17-7-5-16(12-21)6-8-17/h3,5-11H,1,4,13-14H2,2H3 |
| InChIKey | KVSDJLWTVVVHRY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|