C20H24O4 — CID 175305581
2-bicyclo[2.2.1]hept-5-enylmethyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate (PubChem CID 175305581) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
|---|---|
| PubChem CID | 175305581 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
| SMILES | C=CCc1ccc(OCC(=O)OCC2CC3C=CC2C3)c(OC)c1 |
| InChI | InChI=1S/C20H24O4/c1-3-4-14-6-8-18(19(11-14)22-2)23-13-20(21)24-12-17-10-15-5-7-16(17)9-15/h3,5-8,11,15-17H,1,4,9-10,12-13H2,2H3 |
| InChIKey | PPUUFKMHTRLBKX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|