C18H27ClN2O3 — CID 120570765
1-(2,3-dimethylpiperazin-1-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone;hydrochloride (PubChem CID 120570765) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-(2,3-dimethylpiperazin-1-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone;hydrochloride.
| Compound Name | 1-(2,3-dimethylpiperazin-1-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120570765 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(2,3-dimethylpiperazin-1-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone;hydrochloride |
| SMILES | C=CCc1ccc(OCC(=O)N2CCNC(C)C2C)c(OC)c1.Cl |
| InChI | InChI=1S/C18H26N2O3.ClH/c1-5-6-15-7-8-16(17(11-15)22-4)23-12-18(21)20-10-9-19-13(2)14(20)3;/h5,7-8,11,13-14,19H,1,6,9-10,12H2,2-4H3;1H |
| InChIKey | ZXDHJIZVSZJUGT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|