C22H24FNO3 — CID 86954536
1-(7-fluoro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone (PubChem CID 86954536) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-(7-fluoro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone.
| Compound Name | 1-(7-fluoro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone |
|---|---|
| PubChem CID | 86954536 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-(7-fluoro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-(2-methoxy-4-prop-2-enylphenoxy)ethanone |
| SMILES | C=CCc1ccc(OCC(=O)N2CCc3ccc(F)cc3C2C)c(OC)c1 |
| InChI | InChI=1S/C22H24FNO3/c1-4-5-16-6-9-20(21(12-16)26-3)27-14-22(25)24-11-10-17-7-8-18(23)13-19(17)15(24)2/h4,6-9,12-13,15H,1,5,10-11,14H2,2-3H3 |
| InChIKey | NNFOBRYVMGJVGI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|